C25H33N3O4 — CID 67249290
[(3S)-1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]piperidin-3-yl]carbamic acid (PubChem CID 67249290) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is [(3S)-1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]piperidin-3-yl]carbamic acid.
| Compound Name | [(3S)-1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 67249290 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | [(3S)-1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]piperidin-3-yl]carbamic acid |
| SMILES | Cn1c2c(c3cc(C(=O)N4CCC[C@H](NC(=O)O)C4)ccc31)CC(C1CCOCC1)CC2 |
| InChI | InChI=1S/C25H33N3O4/c1-27-22-6-4-17(16-8-11-32-12-9-16)13-20(22)21-14-18(5-7-23(21)27)24(29)28-10-2-3-19(15-28)26-25(30)31/h5,7,14,16-17,19,26H,2-4,6,8-13,15H2,1H3,(H,30,31)/t17?,19-/m0/s1 |
| InChIKey | RMIUUOIFAFRSCN-NNBQYGFHSA-N |
| XLogP | 3.58 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|