C27H35N3O4 — CID 89200790
prop-1-en-2-yl N-[(3S)-1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]pyrrolidin-3-yl]carbamate (PubChem CID 89200790) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is prop-1-en-2-yl N-[(3S)-1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]pyrrolidin-3-yl]carbamate.
| Compound Name | prop-1-en-2-yl N-[(3S)-1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 89200790 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | prop-1-en-2-yl N-[(3S)-1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]pyrrolidin-3-yl]carbamate |
| SMILES | C=C(C)OC(=O)N[C@H]1CCN(C(=O)c2ccc3c(c2)c2c(n3C)CCC(C3CCOCC3)C2)C1 |
| InChI | InChI=1S/C27H35N3O4/c1-17(2)34-27(32)28-21-8-11-30(16-21)26(31)20-5-7-25-23(15-20)22-14-19(4-6-24(22)29(25)3)18-9-12-33-13-10-18/h5,7,15,18-19,21H,1,4,6,8-14,16H2,2-3H3,(H,28,32)/t19?,21-/m0/s1 |
| InChIKey | CBTWCOIUHGZRAQ-QWAKEFERSA-N |
| XLogP | 4.18 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|