C29H39N3O3 — CID 25195783
2-cyclopropyl-N-[1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]piperidin-3-yl]acetamide (PubChem CID 25195783) has the molecular formula C29H39N3O3 and a molecular weight of 477.65 g/mol. Its IUPAC name is 2-cyclopropyl-N-[1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]piperidin-3-yl]acetamide.
| Compound Name | 2-cyclopropyl-N-[1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 25195783 |
| Molecular Formula | C29H39N3O3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | 2-cyclopropyl-N-[1-[9-methyl-6-(oxan-4-yl)-5,6,7,8-tetrahydrocarbazole-3-carbonyl]piperidin-3-yl]acetamide |
| SMILES | Cn1c2c(c3cc(C(=O)N4CCCC(NC(=O)CC5CC5)C4)ccc31)CC(C1CCOCC1)CC2 |
| InChI | InChI=1S/C29H39N3O3/c1-31-26-8-6-21(20-10-13-35-14-11-20)16-24(26)25-17-22(7-9-27(25)31)29(34)32-12-2-3-23(18-32)30-28(33)15-19-4-5-19/h7,9,17,19-21,23H,2-6,8,10-16,18H2,1H3,(H,30,33) |
| InChIKey | PVXLTSMFPOEQGA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|