C25H33N3O2 — CID 143648699
1-(3-butyl-5-tert-butyl-4-hydroxyphenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone (PubChem CID 143648699) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-(3-butyl-5-tert-butyl-4-hydroxyphenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone.
| Compound Name | 1-(3-butyl-5-tert-butyl-4-hydroxyphenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone |
|---|---|
| PubChem CID | 143648699 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 1-(3-butyl-5-tert-butyl-4-hydroxyphenyl)-2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanone |
| SMILES | [H]/N=c1\n(CC)c2ccccc2n1CC(=O)c1cc(CCCC)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H33N3O2/c1-6-8-11-17-14-18(15-19(23(17)30)25(3,4)5)22(29)16-28-21-13-10-9-12-20(21)27(7-2)24(28)26/h9-10,12-15,26,30H,6-8,11,16H2,1-5H3/b26-24+ |
| InChIKey | REKOOYRCEPLUIT-SHHOIMCASA-N |
| XLogP | 5.17 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |