About hydron;methyl 2-(3-ethyl-2-iminobenzimidazol-1-yl)acetate;bromide
hydron;methyl 2-(3-ethyl-2-iminobenzimidazol-1-yl)acetate;bromide (PubChem CID 658288) has the molecular formula C12H16BrN3O2
and a molecular weight of 314.18 g/mol. Its IUPAC name is hydron;methyl 2-(3-ethyl-2-iminobenzimidazol-1-yl)acetate;bromide.
Molecular Properties
| Compound Name | hydron;methyl 2-(3-ethyl-2-iminobenzimidazol-1-yl)acetate;bromide |
| PubChem CID | 658288 |
| Molecular Formula | C12H16BrN3O2 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | hydron;methyl 2-(3-ethyl-2-iminobenzimidazol-1-yl)acetate;bromide |
| SMILES | [Br-].[H+].[H]/N=c1\n(CC)c2ccccc2n1CC(=O)OC |
| InChI | InChI=1S/C12H15N3O2.BrH/c1-3-14-9-6-4-5-7-10(9)15(12(14)13)8-11(16)17-2;/h4-7,13H,3,8H2,1-2H3;1H/b13-12+; |
| InChIKey | TWIUADMBHBQTRD-UEIGIMKUSA-N |
| XLogP | -1.77 |
| TPSA | 60.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze hydron;methyl 2-(3-ethyl-2-iminobenzimidazol-1-yl)acetate;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;methyl 2-(3-ethyl-2-iminobenzimidazol-1-yl)acetate;bromide?
The IUPAC name of hydron;methyl 2-(3-ethyl-2-iminobenzimidazol-1-yl)acetate;bromide (CID 658288) is hydron;methyl 2-(3-ethyl-2-iminobenzimidazol-1-yl)acetate;bromide.
What is the SMILES notation for hydron;methyl 2-(3-ethyl-2-iminobenzimidazol-1-yl)acetate;bromide?
The canonical SMILES for hydron;methyl 2-(3-ethyl-2-iminobenzimidazol-1-yl)acetate;bromide is [Br-].[H+].[H]/N=c1\n(CC)c2ccccc2n1CC(=O)OC.
What is the InChIKey of hydron;methyl 2-(3-ethyl-2-iminobenzimidazol-1-yl)acetate;bromide?
The InChIKey is TWIUADMBHBQTRD-UEIGIMKUSA-N. The full InChI is InChI=1S/C12H15N3O2.BrH/c1-3-14-9-6-4-5-7-10(9)15(12(14)13)8-11(16)17-2;/h4-7,13H,3,8H2,1-2H3;1H/b13-12+;.
What are the key properties of hydron;methyl 2-(3-ethyl-2-iminobenzimidazol-1-yl)acetate;bromide?
hydron;methyl 2-(3-ethyl-2-iminobenzimidazol-1-yl)acetate;bromide has a molecular weight of 314.18 g/mol, XLogP of -1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;methyl 2-(3-ethyl-2-iminobenzimidazol-1-yl)acetate;bromide is sourced from PubChem (CID 658288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).