C16H25N4O2+ — CID 5029619
diethyl-[2-[2-imino-3-(2-methoxy-2-oxoethyl)benzimidazol-1-yl]ethyl]azanium (PubChem CID 5029619) has the molecular formula C16H25N4O2+ and a molecular weight of 305.40 g/mol. Its IUPAC name is diethyl-[2-[2-imino-3-(2-methoxy-2-oxoethyl)benzimidazol-1-yl]ethyl]azanium.
| Compound Name | diethyl-[2-[2-imino-3-(2-methoxy-2-oxoethyl)benzimidazol-1-yl]ethyl]azanium |
|---|---|
| PubChem CID | 5029619 |
| Molecular Formula | C16H25N4O2+ |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | diethyl-[2-[2-imino-3-(2-methoxy-2-oxoethyl)benzimidazol-1-yl]ethyl]azanium |
| SMILES | [H]/N=c1\n(CC[NH+](CC)CC)c2ccccc2n1CC(=O)OC |
| InChI | InChI=1S/C16H24N4O2/c1-4-18(5-2)10-11-19-13-8-6-7-9-14(13)20(16(19)17)12-15(21)22-3/h6-9,17H,4-5,10-12H2,1-3H3/p+1/b17-16+ |
| InChIKey | RPQDYFHQCKXMFR-WUKNDPDISA-O |
| XLogP | 0.02 |
| TPSA | 64.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |