C30H44BrN3O2 — CID 44889171
1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(3-heptyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide (PubChem CID 44889171) has the molecular formula C30H44BrN3O2 and a molecular weight of 558.61 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(3-heptyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide.
| Compound Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(3-heptyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 44889171 |
| Molecular Formula | C30H44BrN3O2 |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(3-heptyl-2-iminobenzimidazol-1-yl)ethanone;hydrobromide |
| SMILES | Br.[H]/N=c1\n(CCCCCCC)c2ccccc2n1CC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H43N3O2.BrH/c1-8-9-10-11-14-17-32-24-15-12-13-16-25(24)33(28(32)31)20-26(34)21-18-22(29(2,3)4)27(35)23(19-21)30(5,6)7;/h12-13,15-16,18-19,31,35H,8-11,14,17,20H2,1-7H3;1H/b31-28+; |
| InChIKey | MWYLXYGEPHRPMU-KAHIUYCRSA-N |
| XLogP | 7.65 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|