C19H27ClN6 — CID 143652685
2-N-(4-chloro-3-methylphenyl)-4-[cyclopentyl(ethylamino)amino]-5-N-methylpyrimidine-2,5-diamine (PubChem CID 143652685) has the molecular formula C19H27ClN6 and a molecular weight of 374.92 g/mol. Its IUPAC name is 2-N-(4-chloro-3-methylphenyl)-4-[cyclopentyl(ethylamino)amino]-5-N-methylpyrimidine-2,5-diamine.
| Compound Name | 2-N-(4-chloro-3-methylphenyl)-4-[cyclopentyl(ethylamino)amino]-5-N-methylpyrimidine-2,5-diamine |
|---|---|
| PubChem CID | 143652685 |
| Molecular Formula | C19H27ClN6 |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-N-(4-chloro-3-methylphenyl)-4-[cyclopentyl(ethylamino)amino]-5-N-methylpyrimidine-2,5-diamine |
| SMILES | CCNN(c1nc(Nc2ccc(Cl)c(C)c2)ncc1NC)C1CCCC1 |
| InChI | InChI=1S/C19H27ClN6/c1-4-23-26(15-7-5-6-8-15)18-17(21-3)12-22-19(25-18)24-14-9-10-16(20)13(2)11-14/h9-12,15,21,23H,4-8H2,1-3H3,(H,22,24,25) |
| InChIKey | FYPOVIMPFDHDQI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|