C32H29FN3O3PS — CID 143652930
N-[3-fluoro-4-[2-(4-propylphenyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N'-methyl-N'-(4-phosphanylphenyl)propanediamide (PubChem CID 143652930) has the molecular formula C32H29FN3O3PS and a molecular weight of 585.64 g/mol. Its IUPAC name is N-[3-fluoro-4-[2-(4-propylphenyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N'-methyl-N'-(4-phosphanylphenyl)propanediamide.
| Compound Name | N-[3-fluoro-4-[2-(4-propylphenyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N'-methyl-N'-(4-phosphanylphenyl)propanediamide |
|---|---|
| PubChem CID | 143652930 |
| Molecular Formula | C32H29FN3O3PS |
| Molecular Weight | 585.64 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | N-[3-fluoro-4-[2-(4-propylphenyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N'-methyl-N'-(4-phosphanylphenyl)propanediamide |
| SMILES | CCCc1ccc(-c2cc3nccc(Oc4ccc(NC(=O)CC(=O)N(C)c5ccc(P)cc5)cc4F)c3s2)cc1 |
| InChI | InChI=1S/C32H29FN3O3PS/c1-3-4-20-5-7-21(8-6-20)29-18-26-32(41-29)28(15-16-34-26)39-27-14-9-22(17-25(27)33)35-30(37)19-31(38)36(2)23-10-12-24(40)13-11-23/h5-18H,3-4,19,40H2,1-2H3,(H,35,37) |
| InChIKey | VVVGCCFIQXOMHP-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.64 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|