C33H30F2N4O4S — CID 129281297
N-[3-fluoro-4-[[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]-1-benzothiophen-7-yl]oxy]phenyl]-N'-(4-fluorophenyl)-N'-methylpropanediamide (PubChem CID 129281297) has the molecular formula C33H30F2N4O4S and a molecular weight of 616.69 g/mol. Its IUPAC name is N-[3-fluoro-4-[[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]-1-benzothiophen-7-yl]oxy]phenyl]-N'-(4-fluorophenyl)-N'-methylpropanediamide.
| Compound Name | N-[3-fluoro-4-[[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]-1-benzothiophen-7-yl]oxy]phenyl]-N'-(4-fluorophenyl)-N'-methylpropanediamide |
|---|---|
| PubChem CID | 129281297 |
| Molecular Formula | C33H30F2N4O4S |
| Molecular Weight | 616.69 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | N-[3-fluoro-4-[[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]-1-benzothiophen-7-yl]oxy]phenyl]-N'-(4-fluorophenyl)-N'-methylpropanediamide |
| SMILES | COCCNCc1ccc(-c2cc3cccc(Oc4ccc(NC(=O)CC(=O)N(C)c5ccc(F)cc5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C33H30F2N4O4S/c1-39(25-10-7-23(34)8-11-25)32(41)18-31(40)38-24-9-13-28(26(35)17-24)43-29-5-3-4-22-16-30(44-33(22)29)27-12-6-21(20-37-27)19-36-14-15-42-2/h3-13,16-17,20,36H,14-15,18-19H2,1-2H3,(H,38,40) |
| InChIKey | BGLSLVFMCWEVDW-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.69 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|