C12H21N5O2 — CID 143654255
2-amino-9-[(5R)-5-methyloxolan-2-yl]-7,8-dihydro-1H-purin-6-one;ethane (PubChem CID 143654255) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-amino-9-[(5R)-5-methyloxolan-2-yl]-7,8-dihydro-1H-purin-6-one;ethane.
| Compound Name | 2-amino-9-[(5R)-5-methyloxolan-2-yl]-7,8-dihydro-1H-purin-6-one;ethane |
|---|---|
| PubChem CID | 143654255 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-amino-9-[(5R)-5-methyloxolan-2-yl]-7,8-dihydro-1H-purin-6-one;ethane |
| SMILES | CC.C[C@@H]1CCC(N2CNc3c2nc(N)[nH]c3=O)O1 |
| InChI | InChI=1S/C10H15N5O2.C2H6/c1-5-2-3-6(17-5)15-4-12-7-8(15)13-10(11)14-9(7)16;1-2/h5-6,12H,2-4H2,1H3,(H3,11,13,14,16);1-2H3/t5-,6?;/m1./s1 |
| InChIKey | OIPHTTSCKZXOOM-VQALBSKCSA-N |
| XLogP | 1.09 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |