C25H20BrN3O — CID 143655478
5-bromo-3-[4-(3-methoxy-4-methylphenyl)-5-phenyl-1H-imidazol-2-yl]-1H-indole (PubChem CID 143655478) has the molecular formula C25H20BrN3O and a molecular weight of 458.36 g/mol. Its IUPAC name is 5-bromo-3-[4-(3-methoxy-4-methylphenyl)-5-phenyl-1H-imidazol-2-yl]-1H-indole.
| Compound Name | 5-bromo-3-[4-(3-methoxy-4-methylphenyl)-5-phenyl-1H-imidazol-2-yl]-1H-indole |
|---|---|
| PubChem CID | 143655478 |
| Molecular Formula | C25H20BrN3O |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 5-bromo-3-[4-(3-methoxy-4-methylphenyl)-5-phenyl-1H-imidazol-2-yl]-1H-indole |
| SMILES | COc1cc(-c2nc(-c3c[nH]c4ccc(Br)cc34)[nH]c2-c2ccccc2)ccc1C |
| InChI | InChI=1S/C25H20BrN3O/c1-15-8-9-17(12-22(15)30-2)24-23(16-6-4-3-5-7-16)28-25(29-24)20-14-27-21-11-10-18(26)13-19(20)21/h3-14,27H,1-2H3,(H,28,29) |
| InChIKey | OIRGXJVKGWNETR-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|