C14H29NS — CID 143657139
ethane;(5Z)-2-ethenylsulfanyl-5-methylhepta-1,5-dien-3-amine (PubChem CID 143657139) has the molecular formula C14H29NS and a molecular weight of 243.46 g/mol. Its IUPAC name is ethane;(5Z)-2-ethenylsulfanyl-5-methylhepta-1,5-dien-3-amine.
| Compound Name | ethane;(5Z)-2-ethenylsulfanyl-5-methylhepta-1,5-dien-3-amine |
|---|---|
| PubChem CID | 143657139 |
| Molecular Formula | C14H29NS |
| Molecular Weight | 243.46 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | ethane;(5Z)-2-ethenylsulfanyl-5-methylhepta-1,5-dien-3-amine |
| SMILES | C=CSC(=C)C(N)C/C(C)=C\C.CC.CC |
| InChI | InChI=1S/C10H17NS.2C2H6/c1-5-8(3)7-10(11)9(4)12-6-2;2*1-2/h5-6,10H,2,4,7,11H2,1,3H3;2*1-2H3/b8-5-;; |
| InChIKey | CBTSUVUVGPPFFG-XTKZWJJBSA-N |
| XLogP | 5.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|