C11H17F3N2O — CID 143657548
methanamine;4,4,4-trifluoro-3-[[(3E)-hexa-1,3,5-trien-3-yl]amino]butanal (PubChem CID 143657548) has the molecular formula C11H17F3N2O and a molecular weight of 250.26 g/mol. Its IUPAC name is methanamine;4,4,4-trifluoro-3-[[(3E)-hexa-1,3,5-trien-3-yl]amino]butanal.
| Compound Name | methanamine;4,4,4-trifluoro-3-[[(3E)-hexa-1,3,5-trien-3-yl]amino]butanal |
|---|---|
| PubChem CID | 143657548 |
| Molecular Formula | C11H17F3N2O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | methanamine;4,4,4-trifluoro-3-[[(3E)-hexa-1,3,5-trien-3-yl]amino]butanal |
| SMILES | C=C/C=C(\C=C)NC(CC=O)C(F)(F)F.CN |
| InChI | InChI=1S/C10H12F3NO.CH5N/c1-3-5-8(4-2)14-9(6-7-15)10(11,12)13;1-2/h3-5,7,9,14H,1-2,6H2;2H2,1H3/b8-5+; |
| InChIKey | IJWFWFGFQPORKX-HAAWTFQLSA-N |
| XLogP | 1.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|