C12H17F3N2O — CID 143768458
4,4,4-trifluoro-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-(methylamino)butanamide (PubChem CID 143768458) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-(methylamino)butanamide.
| Compound Name | 4,4,4-trifluoro-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-(methylamino)butanamide |
|---|---|
| PubChem CID | 143768458 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 4,4,4-trifluoro-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-(methylamino)butanamide |
| SMILES | C=C/C(=C\C=C/C)NC(=O)CC(NC)C(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O/c1-4-6-7-9(5-2)17-11(18)8-10(16-3)12(13,14)15/h4-7,10,16H,2,8H2,1,3H3,(H,17,18)/b6-4-,9-7+ |
| InChIKey | ZIEJNFRMKOVJNA-UNQQQNFISA-N |
| XLogP | 2.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|