C10H12F3IN2O — CID 143768843
4,4,4-trifluoro-3-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-N-iodobutanamide (PubChem CID 143768843) has the molecular formula C10H12F3IN2O and a molecular weight of 360.12 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-N-iodobutanamide.
| Compound Name | 4,4,4-trifluoro-3-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-N-iodobutanamide |
|---|---|
| PubChem CID | 143768843 |
| Molecular Formula | C10H12F3IN2O |
| Molecular Weight | 360.12 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 4,4,4-trifluoro-3-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-N-iodobutanamide |
| SMILES | C=C/C=C(\C=C)NC(CC(=O)NI)C(F)(F)F |
| InChI | InChI=1S/C10H12F3IN2O/c1-3-5-7(4-2)15-8(10(11,12)13)6-9(17)16-14/h3-5,8,15H,1-2,6H2,(H,16,17)/b7-5+ |
| InChIKey | UGSBAIDOZLSDJA-FNORWQNLSA-N |
| XLogP | 2.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.12 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|