C13H21F3N2O — CID 143768468
ethane;4,4,4-trifluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]-3-(methylamino)butanamide (PubChem CID 143768468) has the molecular formula C13H21F3N2O and a molecular weight of 278.32 g/mol. Its IUPAC name is ethane;4,4,4-trifluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]-3-(methylamino)butanamide.
| Compound Name | ethane;4,4,4-trifluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]-3-(methylamino)butanamide |
|---|---|
| PubChem CID | 143768468 |
| Molecular Formula | C13H21F3N2O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | ethane;4,4,4-trifluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]-3-(methylamino)butanamide |
| SMILES | C=C/C=C(\C=C)NC(=O)CC(NC)C(F)(F)F.CC |
| InChI | InChI=1S/C11H15F3N2O.C2H6/c1-4-6-8(5-2)16-10(17)7-9(15-3)11(12,13)14;1-2/h4-6,9,15H,1-2,7H2,3H3,(H,16,17);1-2H3/b8-6+; |
| InChIKey | RARBAXWDNZLOGH-WVLIHFOGSA-N |
| XLogP | 2.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|