C11H16F3N3O — CID 143768717
4,4,4-trifluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-methylhydrazinyl)butanamide (PubChem CID 143768717) has the molecular formula C11H16F3N3O and a molecular weight of 263.26 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-methylhydrazinyl)butanamide.
| Compound Name | 4,4,4-trifluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-methylhydrazinyl)butanamide |
|---|---|
| PubChem CID | 143768717 |
| Molecular Formula | C11H16F3N3O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 4,4,4-trifluoro-N-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-methylhydrazinyl)butanamide |
| SMILES | C=C/C=C(\C=C)NC(=O)CC(NNC)C(F)(F)F |
| InChI | InChI=1S/C11H16F3N3O/c1-4-6-8(5-2)16-10(18)7-9(17-15-3)11(12,13)14/h4-6,9,15,17H,1-2,7H2,3H3,(H,16,18)/b8-6+ |
| InChIKey | IUVYSZOMMIZHQN-SOFGYWHQSA-N |
| XLogP | 1.40 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|