C27H23F3N2OS — CID 143659734
4-[3-(3-piperidin-4-ylsulfanylphenoxy)phenyl]-8-(trifluoromethyl)quinoline (PubChem CID 143659734) has the molecular formula C27H23F3N2OS and a molecular weight of 480.56 g/mol. Its IUPAC name is 4-[3-(3-piperidin-4-ylsulfanylphenoxy)phenyl]-8-(trifluoromethyl)quinoline.
| Compound Name | 4-[3-(3-piperidin-4-ylsulfanylphenoxy)phenyl]-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 143659734 |
| Molecular Formula | C27H23F3N2OS |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 4-[3-(3-piperidin-4-ylsulfanylphenoxy)phenyl]-8-(trifluoromethyl)quinoline |
| SMILES | FC(F)(F)c1cccc2c(-c3cccc(Oc4cccc(SC5CCNCC5)c4)c3)ccnc12 |
| InChI | InChI=1S/C27H23F3N2OS/c28-27(29,30)25-9-3-8-24-23(12-15-32-26(24)25)18-4-1-5-19(16-18)33-20-6-2-7-22(17-20)34-21-10-13-31-14-11-21/h1-9,12,15-17,21,31H,10-11,13-14H2 |
| InChIKey | SGBMZRIDBNMDEK-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |