C22H26F3N5O4 — CID 143659941
[(Z)-[amino-[4-[[(2-aminoacetyl)amino]methyl]phenyl]methylidene]amino] acetate;2,2,2-trifluoro-N-[(3-methylphenyl)methyl]acetamide (PubChem CID 143659941) has the molecular formula C22H26F3N5O4 and a molecular weight of 481.48 g/mol. Its IUPAC name is [(Z)-[amino-[4-[[(2-aminoacetyl)amino]methyl]phenyl]methylidene]amino] acetate;2,2,2-trifluoro-N-[(3-methylphenyl)methyl]acetamide.
| Compound Name | [(Z)-[amino-[4-[[(2-aminoacetyl)amino]methyl]phenyl]methylidene]amino] acetate;2,2,2-trifluoro-N-[(3-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 143659941 |
| Molecular Formula | C22H26F3N5O4 |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [(Z)-[amino-[4-[[(2-aminoacetyl)amino]methyl]phenyl]methylidene]amino] acetate;2,2,2-trifluoro-N-[(3-methylphenyl)methyl]acetamide |
| SMILES | CC(=O)O/N=C(\N)c1ccc(CNC(=O)CN)cc1.Cc1cccc(CNC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16N4O3.C10H10F3NO/c1-8(17)19-16-12(14)10-4-2-9(3-5-10)7-15-11(18)6-13;1-7-3-2-4-8(5-7)6-14-9(15)10(11,12)13/h2-5H,6-7,13H2,1H3,(H2,14,16)(H,15,18);2-5H,6H2,1H3,(H,14,15) |
| InChIKey | CHMBAECGOUHEHD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|