C28H33F3N4O6 — CID 91299788
tert-butyl (3R)-4-[[4-[(E)-N'-acetyloxycarbamimidoyl]phenyl]methylamino]-4-oxo-3-[[3-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]methyl]butanoate (PubChem CID 91299788) has the molecular formula C28H33F3N4O6 and a molecular weight of 578.59 g/mol. Its IUPAC name is tert-butyl (3R)-4-[[4-[(E)-N'-acetyloxycarbamimidoyl]phenyl]methylamino]-4-oxo-3-[[3-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]methyl]butanoate.
| Compound Name | tert-butyl (3R)-4-[[4-[(E)-N'-acetyloxycarbamimidoyl]phenyl]methylamino]-4-oxo-3-[[3-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]methyl]butanoate |
|---|---|
| PubChem CID | 91299788 |
| Molecular Formula | C28H33F3N4O6 |
| Molecular Weight | 578.59 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | tert-butyl (3R)-4-[[4-[(E)-N'-acetyloxycarbamimidoyl]phenyl]methylamino]-4-oxo-3-[[3-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]methyl]butanoate |
| SMILES | CC(=O)O/N=C(/N)c1ccc(CNC(=O)[C@@H](CC(=O)OC(C)(C)C)Cc2cccc(CNC(=O)C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C28H33F3N4O6/c1-17(36)41-35-24(32)21-10-8-18(9-11-21)15-33-25(38)22(14-23(37)40-27(2,3)4)13-19-6-5-7-20(12-19)16-34-26(39)28(29,30)31/h5-12,22H,13-16H2,1-4H3,(H2,32,35)(H,33,38)(H,34,39)/t22-/m1/s1 |
| InChIKey | BJSCYSGHAYSXNU-JOCHJYFZSA-N |
| XLogP | 3.26 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.59 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|