C30H31ClN2O2 — CID 143661146
[3-[7-chloro-6-(3-methylphenyl)-4-(2-piperidin-2-ylethoxy)quinolin-3-yl]phenyl]methanol (PubChem CID 143661146) has the molecular formula C30H31ClN2O2 and a molecular weight of 487.04 g/mol. Its IUPAC name is [3-[7-chloro-6-(3-methylphenyl)-4-(2-piperidin-2-ylethoxy)quinolin-3-yl]phenyl]methanol.
| Compound Name | [3-[7-chloro-6-(3-methylphenyl)-4-(2-piperidin-2-ylethoxy)quinolin-3-yl]phenyl]methanol |
|---|---|
| PubChem CID | 143661146 |
| Molecular Formula | C30H31ClN2O2 |
| Molecular Weight | 487.04 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | [3-[7-chloro-6-(3-methylphenyl)-4-(2-piperidin-2-ylethoxy)quinolin-3-yl]phenyl]methanol |
| SMILES | Cc1cccc(-c2cc3c(OCCC4CCCCN4)c(-c4cccc(CO)c4)cnc3cc2Cl)c1 |
| InChI | InChI=1S/C30H31ClN2O2/c1-20-6-4-8-22(14-20)25-16-26-29(17-28(25)31)33-18-27(23-9-5-7-21(15-23)19-34)30(26)35-13-11-24-10-2-3-12-32-24/h4-9,14-18,24,32,34H,2-3,10-13,19H2,1H3 |
| InChIKey | MOODDJZXZWXJHP-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.04 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |