C29H27ClN2O2 — CID 24955159
3-[4-[2-(azetidin-2-yl)ethoxy]-7-chloro-3-(3,5-dimethylphenyl)quinolin-6-yl]benzaldehyde (PubChem CID 24955159) has the molecular formula C29H27ClN2O2 and a molecular weight of 471.00 g/mol. Its IUPAC name is 3-[4-[2-(azetidin-2-yl)ethoxy]-7-chloro-3-(3,5-dimethylphenyl)quinolin-6-yl]benzaldehyde.
| Compound Name | 3-[4-[2-(azetidin-2-yl)ethoxy]-7-chloro-3-(3,5-dimethylphenyl)quinolin-6-yl]benzaldehyde |
|---|---|
| PubChem CID | 24955159 |
| Molecular Formula | C29H27ClN2O2 |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 3-[4-[2-(azetidin-2-yl)ethoxy]-7-chloro-3-(3,5-dimethylphenyl)quinolin-6-yl]benzaldehyde |
| SMILES | Cc1cc(C)cc(-c2cnc3cc(Cl)c(-c4cccc(C=O)c4)cc3c2OCCC2CCN2)c1 |
| InChI | InChI=1S/C29H27ClN2O2/c1-18-10-19(2)12-22(11-18)26-16-32-28-15-27(30)24(21-5-3-4-20(13-21)17-33)14-25(28)29(26)34-9-7-23-6-8-31-23/h3-5,10-17,23,31H,6-9H2,1-2H3 |
| InChIKey | PXWVTFZZPCDSGM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|