C30H32ClN3O — CID 89271599
2-[7-chloro-3-(3,5-dimethylphenyl)-4-(2-piperidin-2-ylethoxy)quinolin-6-yl]aniline (PubChem CID 89271599) has the molecular formula C30H32ClN3O and a molecular weight of 486.06 g/mol. Its IUPAC name is 2-[7-chloro-3-(3,5-dimethylphenyl)-4-(2-piperidin-2-ylethoxy)quinolin-6-yl]aniline.
| Compound Name | 2-[7-chloro-3-(3,5-dimethylphenyl)-4-(2-piperidin-2-ylethoxy)quinolin-6-yl]aniline |
|---|---|
| PubChem CID | 89271599 |
| Molecular Formula | C30H32ClN3O |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 2-[7-chloro-3-(3,5-dimethylphenyl)-4-(2-piperidin-2-ylethoxy)quinolin-6-yl]aniline |
| SMILES | Cc1cc(C)cc(-c2cnc3cc(Cl)c(-c4ccccc4N)cc3c2OCCC2CCCCN2)c1 |
| InChI | InChI=1S/C30H32ClN3O/c1-19-13-20(2)15-21(14-19)26-18-34-29-17-27(31)24(23-8-3-4-9-28(23)32)16-25(29)30(26)35-12-10-22-7-5-6-11-33-22/h3-4,8-9,13-18,22,33H,5-7,10-12,32H2,1-2H3 |
| InChIKey | BEWNAIKKWMWUOI-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|