C11H18N2O2 — CID 143661407
(3Z,5E)-5-hydroxy-2-methylidene-4-propan-2-ylhepta-3,5-dienehydrazide (PubChem CID 143661407) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (3Z,5E)-5-hydroxy-2-methylidene-4-propan-2-ylhepta-3,5-dienehydrazide.
| Compound Name | (3Z,5E)-5-hydroxy-2-methylidene-4-propan-2-ylhepta-3,5-dienehydrazide |
|---|---|
| PubChem CID | 143661407 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (3Z,5E)-5-hydroxy-2-methylidene-4-propan-2-ylhepta-3,5-dienehydrazide |
| SMILES | C=C(/C=C(C(\O)=C/C)/C(C)C)C(=O)NN |
| InChI | InChI=1S/C11H18N2O2/c1-5-10(14)9(7(2)3)6-8(4)11(15)13-12/h5-7,14H,4,12H2,1-3H3,(H,13,15)/b9-6-,10-5+ |
| InChIKey | WXRCRHLWBUOVFU-SCWCTGRGSA-N |
| XLogP | 1.58 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|