C9H12N2O7 — CID 158985385
(Z)-but-2-enedioic acid;(Z)-4-hydrazinyl-3-methyl-4-oxobut-2-enoic acid (PubChem CID 158985385) has the molecular formula C9H12N2O7 and a molecular weight of 260.20 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(Z)-4-hydrazinyl-3-methyl-4-oxobut-2-enoic acid.
| Compound Name | (Z)-but-2-enedioic acid;(Z)-4-hydrazinyl-3-methyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 158985385 |
| Molecular Formula | C9H12N2O7 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | (Z)-but-2-enedioic acid;(Z)-4-hydrazinyl-3-methyl-4-oxobut-2-enoic acid |
| SMILES | C/C(=C/C(=O)O)C(=O)NN.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C5H8N2O3.C4H4O4/c1-3(2-4(8)9)5(10)7-6;5-3(6)1-2-4(7)8/h2H,6H2,1H3,(H,7,10)(H,8,9);1-2H,(H,5,6)(H,7,8)/b3-2-;2-1- |
| InChIKey | JPMWEVFIXGWUHK-FGRDZWBJSA-N |
| XLogP | -1.28 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|