C14H21N3O2S — CID 143665035
(2R)-2-[[4-(4-methylphenyl)piperazin-1-yl]sulfanylamino]propanoic acid (PubChem CID 143665035) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is (2R)-2-[[4-(4-methylphenyl)piperazin-1-yl]sulfanylamino]propanoic acid.
| Compound Name | (2R)-2-[[4-(4-methylphenyl)piperazin-1-yl]sulfanylamino]propanoic acid |
|---|---|
| PubChem CID | 143665035 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (2R)-2-[[4-(4-methylphenyl)piperazin-1-yl]sulfanylamino]propanoic acid |
| SMILES | Cc1ccc(N2CCN(SN[C@H](C)C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C14H21N3O2S/c1-11-3-5-13(6-4-11)16-7-9-17(10-8-16)20-15-12(2)14(18)19/h3-6,12,15H,7-10H2,1-2H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | CZDQODJHQCKPPT-GFCCVEGCSA-N |
| XLogP | 1.74 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|