C18H24IN3O2S2 — CID 143665038
methyl 2-[[4-[4-(2-iodosulfanylethynyl)phenyl]piperazin-1-yl]sulfanylamino]-3-methylbutanoate (PubChem CID 143665038) has the molecular formula C18H24IN3O2S2 and a molecular weight of 505.45 g/mol. Its IUPAC name is methyl 2-[[4-[4-(2-iodosulfanylethynyl)phenyl]piperazin-1-yl]sulfanylamino]-3-methylbutanoate.
| Compound Name | methyl 2-[[4-[4-(2-iodosulfanylethynyl)phenyl]piperazin-1-yl]sulfanylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 143665038 |
| Molecular Formula | C18H24IN3O2S2 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.04 |
| IUPAC Name | methyl 2-[[4-[4-(2-iodosulfanylethynyl)phenyl]piperazin-1-yl]sulfanylamino]-3-methylbutanoate |
| SMILES | COC(=O)C(NSN1CCN(c2ccc(C#CSI)cc2)CC1)C(C)C |
| InChI | InChI=1S/C18H24IN3O2S2/c1-14(2)17(18(23)24-3)20-26-22-11-9-21(10-12-22)16-6-4-15(5-7-16)8-13-25-19/h4-7,14,17,20H,9-12H2,1-3H3 |
| InChIKey | JJJHUNZLJKWAGK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|