C29H38N6O5S2 — CID 143664993
2-[[4-[4-[2-[3-(cyanomethylcarbamoyl)-4-(2-methoxyethoxy)phenyl]ethynyl]phenyl]piperazin-1-yl]sulfanylamino]-3-methylbutanoic acid;thiohydroxylamine (PubChem CID 143664993) has the molecular formula C29H38N6O5S2 and a molecular weight of 614.79 g/mol. Its IUPAC name is 2-[[4-[4-[2-[3-(cyanomethylcarbamoyl)-4-(2-methoxyethoxy)phenyl]ethynyl]phenyl]piperazin-1-yl]sulfanylamino]-3-methylbutanoic acid;thiohydroxylamine.
| Compound Name | 2-[[4-[4-[2-[3-(cyanomethylcarbamoyl)-4-(2-methoxyethoxy)phenyl]ethynyl]phenyl]piperazin-1-yl]sulfanylamino]-3-methylbutanoic acid;thiohydroxylamine |
|---|---|
| PubChem CID | 143664993 |
| Molecular Formula | C29H38N6O5S2 |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | 2-[[4-[4-[2-[3-(cyanomethylcarbamoyl)-4-(2-methoxyethoxy)phenyl]ethynyl]phenyl]piperazin-1-yl]sulfanylamino]-3-methylbutanoic acid;thiohydroxylamine |
| SMILES | COCCOc1ccc(C#Cc2ccc(N3CCN(SNC(C(=O)O)C(C)C)CC3)cc2)cc1C(=O)NCC#N.NS |
| InChI | InChI=1S/C29H35N5O5S.H3NS/c1-21(2)27(29(36)37)32-40-34-16-14-33(15-17-34)24-9-6-22(7-10-24)4-5-23-8-11-26(39-19-18-38-3)25(20-23)28(35)31-13-12-30;1-2/h6-11,20-21,27,32H,13-19H2,1-3H3,(H,31,35)(H,36,37);2H,1H2 |
| InChIKey | IZGDCWPJNCTUQP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 153.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|