C29H35N5O6S — CID 91228748
2-[[4-[4-[2-[3-(cyanomethylcarbamoyl)-4-propoxyphenyl]ethynyl]phenyl]piperazin-1-yl]-sulfinoamino]-3-methylbutanoic acid (PubChem CID 91228748) has the molecular formula C29H35N5O6S and a molecular weight of 581.70 g/mol. Its IUPAC name is 2-[[4-[4-[2-[3-(cyanomethylcarbamoyl)-4-propoxyphenyl]ethynyl]phenyl]piperazin-1-yl]-sulfinoamino]-3-methylbutanoic acid.
| Compound Name | 2-[[4-[4-[2-[3-(cyanomethylcarbamoyl)-4-propoxyphenyl]ethynyl]phenyl]piperazin-1-yl]-sulfinoamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 91228748 |
| Molecular Formula | C29H35N5O6S |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | 2-[[4-[4-[2-[3-(cyanomethylcarbamoyl)-4-propoxyphenyl]ethynyl]phenyl]piperazin-1-yl]-sulfinoamino]-3-methylbutanoic acid |
| SMILES | CCCOc1ccc(C#Cc2ccc(N3CCN(N(C(C(=O)O)C(C)C)S(=O)O)CC3)cc2)cc1C(=O)NCC#N |
| InChI | InChI=1S/C29H35N5O6S/c1-4-19-40-26-12-9-23(20-25(26)28(35)31-14-13-30)6-5-22-7-10-24(11-8-22)32-15-17-33(18-16-32)34(41(38)39)27(21(2)3)29(36)37/h7-12,20-21,27H,4,14-19H2,1-3H3,(H,31,35)(H,36,37)(H,38,39) |
| InChIKey | FNKDONOVNFYOPM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 146.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|