C33H35N5O6S — CID 87507669
(2R)-2-[[4-[4-[2-[3-(cyanomethylcarbamoyl)-4-phenylmethoxyphenyl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]-3-methylbutanoic acid (PubChem CID 87507669) has the molecular formula C33H35N5O6S and a molecular weight of 629.74 g/mol. Its IUPAC name is (2R)-2-[[4-[4-[2-[3-(cyanomethylcarbamoyl)-4-phenylmethoxyphenyl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[4-[4-[2-[3-(cyanomethylcarbamoyl)-4-phenylmethoxyphenyl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 87507669 |
| Molecular Formula | C33H35N5O6S |
| Molecular Weight | 629.74 g/mol |
| Exact Mass | 629.23 |
| IUPAC Name | (2R)-2-[[4-[4-[2-[3-(cyanomethylcarbamoyl)-4-phenylmethoxyphenyl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NS(=O)(=O)N1CCN(c2ccc(C#Cc3ccc(OCc4ccccc4)c(C(=O)NCC#N)c3)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C33H35N5O6S/c1-24(2)31(33(40)41)36-45(42,43)38-20-18-37(19-21-38)28-13-10-25(11-14-28)8-9-26-12-15-30(29(22-26)32(39)35-17-16-34)44-23-27-6-4-3-5-7-27/h3-7,10-15,22,24,31,36H,17-21,23H2,1-2H3,(H,35,39)(H,40,41)/t31-/m1/s1 |
| InChIKey | QYEWOICXXDPGPQ-WJOKGBTCSA-N |
| XLogP | 2.98 |
| TPSA | 152.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.74 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|