C32H34N4O5S — CID 91245427
methyl (2R)-2-[[4-[4-[2-[4-(benzylamino)-2H-chromen-6-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoate (PubChem CID 91245427) has the molecular formula C32H34N4O5S and a molecular weight of 586.71 g/mol. Its IUPAC name is methyl (2R)-2-[[4-[4-[2-[4-(benzylamino)-2H-chromen-6-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoate.
| Compound Name | methyl (2R)-2-[[4-[4-[2-[4-(benzylamino)-2H-chromen-6-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 91245427 |
| Molecular Formula | C32H34N4O5S |
| Molecular Weight | 586.71 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | methyl (2R)-2-[[4-[4-[2-[4-(benzylamino)-2H-chromen-6-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoate |
| SMILES | COC(=O)[C@@H](C)NS(=O)(=O)N1CCN(c2ccc(C#Cc3ccc4c(c3)C(NCc3ccccc3)=CCO4)cc2)CC1 |
| InChI | InChI=1S/C32H34N4O5S/c1-24(32(37)40-2)34-42(38,39)36-19-17-35(18-20-36)28-13-10-25(11-14-28)8-9-26-12-15-31-29(22-26)30(16-21-41-31)33-23-27-6-4-3-5-7-27/h3-7,10-16,22,24,33-34H,17-21,23H2,1-2H3/t24-/m1/s1 |
| InChIKey | GDKJWHVGTONKGB-XMMPIXPASA-N |
| XLogP | 3.13 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.71 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|