C28H29N3O4S — CID 68605213
(2R)-2-[[4-[4-[2-[8-[(E)-prop-1-enyl]naphthalen-2-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid (PubChem CID 68605213) has the molecular formula C28H29N3O4S and a molecular weight of 503.62 g/mol. Its IUPAC name is (2R)-2-[[4-[4-[2-[8-[(E)-prop-1-enyl]naphthalen-2-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid.
| Compound Name | (2R)-2-[[4-[4-[2-[8-[(E)-prop-1-enyl]naphthalen-2-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 68605213 |
| Molecular Formula | C28H29N3O4S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (2R)-2-[[4-[4-[2-[8-[(E)-prop-1-enyl]naphthalen-2-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid |
| SMILES | C/C=C/c1cccc2ccc(C#Cc3ccc(N4CCN(S(=O)(=O)N[C@H](C)C(=O)O)CC4)cc3)cc12 |
| InChI | InChI=1S/C28H29N3O4S/c1-3-5-24-6-4-7-25-13-10-23(20-27(24)25)9-8-22-11-14-26(15-12-22)30-16-18-31(19-17-30)36(34,35)29-21(2)28(32)33/h3-7,10-15,20-21,29H,16-19H2,1-2H3,(H,32,33)/b5-3+/t21-/m1/s1 |
| InChIKey | BPVLXAHQJCVDGG-LAEWNIMASA-N |
| XLogP | 3.70 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|