C30H32N4O5S — CID 59286048
methyl (2R)-2-[[4-[4-[2-[3-(benzylcarbamoyl)phenyl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoate (PubChem CID 59286048) has the molecular formula C30H32N4O5S and a molecular weight of 560.68 g/mol. Its IUPAC name is methyl (2R)-2-[[4-[4-[2-[3-(benzylcarbamoyl)phenyl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoate.
| Compound Name | methyl (2R)-2-[[4-[4-[2-[3-(benzylcarbamoyl)phenyl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 59286048 |
| Molecular Formula | C30H32N4O5S |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | methyl (2R)-2-[[4-[4-[2-[3-(benzylcarbamoyl)phenyl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoate |
| SMILES | COC(=O)[C@@H](C)NS(=O)(=O)N1CCN(c2ccc(C#Cc3cccc(C(=O)NCc4ccccc4)c3)cc2)CC1 |
| InChI | InChI=1S/C30H32N4O5S/c1-23(30(36)39-2)32-40(37,38)34-19-17-33(18-20-34)28-15-13-24(14-16-28)11-12-25-9-6-10-27(21-25)29(35)31-22-26-7-4-3-5-8-26/h3-10,13-16,21,23,32H,17-20,22H2,1-2H3,(H,31,35)/t23-/m1/s1 |
| InChIKey | ZXZOKASDNYMDBG-HSZRJFAPSA-N |
| XLogP | 2.53 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|