C29H31N3O5S — CID 68935994
(2R)-2-[[4-[4-[2-[6-(cyclopropylmethoxy)naphthalen-2-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid (PubChem CID 68935994) has the molecular formula C29H31N3O5S and a molecular weight of 533.65 g/mol. Its IUPAC name is (2R)-2-[[4-[4-[2-[6-(cyclopropylmethoxy)naphthalen-2-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid.
| Compound Name | (2R)-2-[[4-[4-[2-[6-(cyclopropylmethoxy)naphthalen-2-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 68935994 |
| Molecular Formula | C29H31N3O5S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | (2R)-2-[[4-[4-[2-[6-(cyclopropylmethoxy)naphthalen-2-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid |
| SMILES | C[C@@H](NS(=O)(=O)N1CCN(c2ccc(C#Cc3ccc4cc(OCC5CC5)ccc4c3)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C29H31N3O5S/c1-21(29(33)34)30-38(35,36)32-16-14-31(15-17-32)27-11-7-22(8-12-27)2-3-23-6-9-26-19-28(13-10-25(26)18-23)37-20-24-4-5-24/h6-13,18-19,21,24,30H,4-5,14-17,20H2,1H3,(H,33,34)/t21-/m1/s1 |
| InChIKey | JENPZQNMIOFLBW-OAQYLSRUSA-N |
| XLogP | 3.46 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|