C28H30N4O4S — CID 89080279
4-[4-[2-(1-acetylisoquinolin-7-yl)ethynyl]phenyl]-N-[(2R)-3-methyl-1-oxobutan-2-yl]piperazine-1-sulfonamide (PubChem CID 89080279) has the molecular formula C28H30N4O4S and a molecular weight of 518.64 g/mol. Its IUPAC name is 4-[4-[2-(1-acetylisoquinolin-7-yl)ethynyl]phenyl]-N-[(2R)-3-methyl-1-oxobutan-2-yl]piperazine-1-sulfonamide.
| Compound Name | 4-[4-[2-(1-acetylisoquinolin-7-yl)ethynyl]phenyl]-N-[(2R)-3-methyl-1-oxobutan-2-yl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 89080279 |
| Molecular Formula | C28H30N4O4S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 4-[4-[2-(1-acetylisoquinolin-7-yl)ethynyl]phenyl]-N-[(2R)-3-methyl-1-oxobutan-2-yl]piperazine-1-sulfonamide |
| SMILES | CC(=O)c1nccc2ccc(C#Cc3ccc(N4CCN(S(=O)(=O)N[C@@H](C=O)C(C)C)CC4)cc3)cc12 |
| InChI | InChI=1S/C28H30N4O4S/c1-20(2)27(19-33)30-37(35,36)32-16-14-31(15-17-32)25-10-7-22(8-11-25)4-5-23-6-9-24-12-13-29-28(21(3)34)26(24)18-23/h6-13,18-20,27,30H,14-17H2,1-3H3/t27-/m0/s1 |
| InChIKey | GGKBBGJECIAVMC-MHZLTWQESA-N |
| XLogP | 3.02 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|