C27H33N5O5S — CID 90708108
(2R)-2-[[4-[4-[2-[4-(methoxyamino)-1,2-dihydroquinolin-6-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]-3-methylbutanoic acid (PubChem CID 90708108) has the molecular formula C27H33N5O5S and a molecular weight of 539.66 g/mol. Its IUPAC name is (2R)-2-[[4-[4-[2-[4-(methoxyamino)-1,2-dihydroquinolin-6-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[4-[4-[2-[4-(methoxyamino)-1,2-dihydroquinolin-6-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 90708108 |
| Molecular Formula | C27H33N5O5S |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | (2R)-2-[[4-[4-[2-[4-(methoxyamino)-1,2-dihydroquinolin-6-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]-3-methylbutanoic acid |
| SMILES | CONC1=CCNc2ccc(C#Cc3ccc(N4CCN(S(=O)(=O)N[C@@H](C(=O)O)C(C)C)CC4)cc3)cc21 |
| InChI | InChI=1S/C27H33N5O5S/c1-19(2)26(27(33)34)30-38(35,36)32-16-14-31(15-17-32)22-9-6-20(7-10-22)4-5-21-8-11-24-23(18-21)25(29-37-3)12-13-28-24/h6-12,18-19,26,28-30H,13-17H2,1-3H3,(H,33,34)/t26-/m1/s1 |
| InChIKey | GICAVARKXLSQKH-AREMUKBSSA-N |
| XLogP | 2.07 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|