C27H27N3O4S — CID 25012876
(2R)-2-[[4-[4-[2-(8-ethenylnaphthalen-2-yl)ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid (PubChem CID 25012876) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is (2R)-2-[[4-[4-[2-(8-ethenylnaphthalen-2-yl)ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid.
| Compound Name | (2R)-2-[[4-[4-[2-(8-ethenylnaphthalen-2-yl)ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 25012876 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | (2R)-2-[[4-[4-[2-(8-ethenylnaphthalen-2-yl)ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid |
| SMILES | C=Cc1cccc2ccc(C#Cc3ccc(N4CCN(S(=O)(=O)N[C@H](C)C(=O)O)CC4)cc3)cc12 |
| InChI | InChI=1S/C27H27N3O4S/c1-3-23-5-4-6-24-12-9-22(19-26(23)24)8-7-21-10-13-25(14-11-21)29-15-17-30(18-16-29)35(33,34)28-20(2)27(31)32/h3-6,9-14,19-20,28H,1,15-18H2,2H3,(H,31,32)/t20-/m1/s1 |
| InChIKey | CJHJMNZALDFXHT-HXUWFJFHSA-N |
| XLogP | 3.31 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|