C30H32N4O6S — CID 25012553
(2R)-2-[[4-[2-ethynyl-4-[8-(morpholine-4-carbonyl)naphthalen-2-yl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid (PubChem CID 25012553) has the molecular formula C30H32N4O6S and a molecular weight of 576.68 g/mol. Its IUPAC name is (2R)-2-[[4-[2-ethynyl-4-[8-(morpholine-4-carbonyl)naphthalen-2-yl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid.
| Compound Name | (2R)-2-[[4-[2-ethynyl-4-[8-(morpholine-4-carbonyl)naphthalen-2-yl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 25012553 |
| Molecular Formula | C30H32N4O6S |
| Molecular Weight | 576.68 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | (2R)-2-[[4-[2-ethynyl-4-[8-(morpholine-4-carbonyl)naphthalen-2-yl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid |
| SMILES | C#Cc1cc(-c2ccc3cccc(C(=O)N4CCOCC4)c3c2)ccc1N1CCN(S(=O)(=O)N[C@H](C)C(=O)O)CC1 |
| InChI | InChI=1S/C30H32N4O6S/c1-3-22-19-24(9-10-28(22)32-11-13-34(14-12-32)41(38,39)31-21(2)30(36)37)25-8-7-23-5-4-6-26(27(23)20-25)29(35)33-15-17-40-18-16-33/h1,4-10,19-21,31H,11-18H2,2H3,(H,36,37)/t21-/m1/s1 |
| InChIKey | DGKNAHOXEYAUHO-OAQYLSRUSA-N |
| XLogP | 2.39 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.68 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|