C34H36FN5O6S — CID 91296252
2-[[4-[4-[2-[3-[2-(4-fluorophenyl)ethyl]-1-methyl-2,4-dioxoquinazolin-6-yl]ethynyl]phenyl]piperazin-1-yl]-sulfinoamino]-3-methylbutanoic acid (PubChem CID 91296252) has the molecular formula C34H36FN5O6S and a molecular weight of 661.76 g/mol. Its IUPAC name is 2-[[4-[4-[2-[3-[2-(4-fluorophenyl)ethyl]-1-methyl-2,4-dioxoquinazolin-6-yl]ethynyl]phenyl]piperazin-1-yl]-sulfinoamino]-3-methylbutanoic acid.
| Compound Name | 2-[[4-[4-[2-[3-[2-(4-fluorophenyl)ethyl]-1-methyl-2,4-dioxoquinazolin-6-yl]ethynyl]phenyl]piperazin-1-yl]-sulfinoamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 91296252 |
| Molecular Formula | C34H36FN5O6S |
| Molecular Weight | 661.76 g/mol |
| Exact Mass | 661.24 |
| IUPAC Name | 2-[[4-[4-[2-[3-[2-(4-fluorophenyl)ethyl]-1-methyl-2,4-dioxoquinazolin-6-yl]ethynyl]phenyl]piperazin-1-yl]-sulfinoamino]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)N(N1CCN(c2ccc(C#Cc3ccc4c(c3)c(=O)n(CCc3ccc(F)cc3)c(=O)n4C)cc2)CC1)S(=O)O |
| InChI | InChI=1S/C34H36FN5O6S/c1-23(2)31(33(42)43)40(47(45)46)38-20-18-37(19-21-38)28-13-8-24(9-14-28)4-5-26-10-15-30-29(22-26)32(41)39(34(44)36(30)3)17-16-25-6-11-27(35)12-7-25/h6-15,22-23,31H,16-21H2,1-3H3,(H,42,43)(H,45,46) |
| InChIKey | LPWHIGXFEMBNOK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.76 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|