C16H21N3O2S — CID 143665007
methyl (2R)-2-[[4-(4-ethynylphenyl)piperazin-1-yl]sulfanylamino]propanoate (PubChem CID 143665007) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is methyl (2R)-2-[[4-(4-ethynylphenyl)piperazin-1-yl]sulfanylamino]propanoate.
| Compound Name | methyl (2R)-2-[[4-(4-ethynylphenyl)piperazin-1-yl]sulfanylamino]propanoate |
|---|---|
| PubChem CID | 143665007 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | methyl (2R)-2-[[4-(4-ethynylphenyl)piperazin-1-yl]sulfanylamino]propanoate |
| SMILES | C#Cc1ccc(N2CCN(SN[C@H](C)C(=O)OC)CC2)cc1 |
| InChI | InChI=1S/C16H21N3O2S/c1-4-14-5-7-15(8-6-14)18-9-11-19(12-10-18)22-17-13(2)16(20)21-3/h1,5-8,13,17H,9-12H2,2-3H3/t13-/m1/s1 |
| InChIKey | WALMIGGRLCXLTD-CYBMUJFWSA-N |
| XLogP | 1.50 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|