C14H20N2O3 — CID 143665951
4-methoxy-1,3-dimethylbenzimidazol-2-one;oxolane (PubChem CID 143665951) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 4-methoxy-1,3-dimethylbenzimidazol-2-one;oxolane.
| Compound Name | 4-methoxy-1,3-dimethylbenzimidazol-2-one;oxolane |
|---|---|
| PubChem CID | 143665951 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 4-methoxy-1,3-dimethylbenzimidazol-2-one;oxolane |
| SMILES | C1CCOC1.COc1cccc2c1n(C)c(=O)n2C |
| InChI | InChI=1S/C10H12N2O2.C4H8O/c1-11-7-5-4-6-8(14-3)9(7)12(2)10(11)13;1-2-4-5-3-1/h4-6H,1-3H3;1-4H2 |
| InChIKey | NVHXFYMFSMHPAL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 45.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |