C23H23NO2 — CID 143668322
1-[4-[4-[1-[(2E,4Z)-6-aminohepta-2,4,6-trien-3-yl]oxyethenyl]phenyl]phenyl]ethanone (PubChem CID 143668322) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-[4-[4-[1-[(2E,4Z)-6-aminohepta-2,4,6-trien-3-yl]oxyethenyl]phenyl]phenyl]ethanone.
| Compound Name | 1-[4-[4-[1-[(2E,4Z)-6-aminohepta-2,4,6-trien-3-yl]oxyethenyl]phenyl]phenyl]ethanone |
|---|---|
| PubChem CID | 143668322 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-[4-[4-[1-[(2E,4Z)-6-aminohepta-2,4,6-trien-3-yl]oxyethenyl]phenyl]phenyl]ethanone |
| SMILES | C=C(N)/C=C\C(=C/C)OC(=C)c1ccc(-c2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C23H23NO2/c1-5-23(15-6-16(2)24)26-18(4)20-9-13-22(14-10-20)21-11-7-19(8-12-21)17(3)25/h5-15H,2,4,24H2,1,3H3/b15-6-,23-5+ |
| InChIKey | PNLVRTWLFPZBJQ-PTPQLWPUSA-N |
| XLogP | 5.48 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|