C23H27ClO6 — CID 11026463
[(2E,4Z)-5-ethoxy-1,5-bis(4-methylphenyl)penta-2,4-dienylidene]-ethyloxidanium perchlorate (PubChem CID 11026463) has the molecular formula C23H27ClO6 and a molecular weight of 434.92 g/mol. Its IUPAC name is [(2E,4Z)-5-ethoxy-1,5-bis(4-methylphenyl)penta-2,4-dienylidene]-ethyloxidanium perchlorate.
| Compound Name | [(2E,4Z)-5-ethoxy-1,5-bis(4-methylphenyl)penta-2,4-dienylidene]-ethyloxidanium perchlorate |
|---|---|
| PubChem CID | 11026463 |
| Molecular Formula | C23H27ClO6 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | [(2E,4Z)-5-ethoxy-1,5-bis(4-methylphenyl)penta-2,4-dienylidene]-ethyloxidanium perchlorate |
| SMILES | CCO/C(=C\C=C\C(=[O+]/CC)c1ccc(C)cc1)c1ccc(C)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H27O2.ClHO4/c1-5-24-22(20-14-10-18(3)11-15-20)8-7-9-23(25-6-2)21-16-12-19(4)13-17-21;2-1(3,4)5/h7-17H,5-6H2,1-4H3;(H,2,3,4,5)/q+1;/p-1/b8-7+,23-9-; |
| InChIKey | WXROTRMHCNCAED-BBUQZYCUSA-M |
| XLogP | 0.92 |
| TPSA | 112.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|