C20H25N4O3S+ — CID 143668799
[5-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-2-hydroxyphenyl]-ethyl-methylazanium (PubChem CID 143668799) has the molecular formula C20H25N4O3S+ and a molecular weight of 401.51 g/mol. Its IUPAC name is [5-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-2-hydroxyphenyl]-ethyl-methylazanium.
| Compound Name | [5-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-2-hydroxyphenyl]-ethyl-methylazanium |
|---|---|
| PubChem CID | 143668799 |
| Molecular Formula | C20H25N4O3S+ |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | [5-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-2-hydroxyphenyl]-ethyl-methylazanium |
| SMILES | CC[NH+](C)c1cc(-n2c(-c3cc(C(C)C)c(O)cc3O)n[nH]c2=S)ccc1O |
| InChI | InChI=1S/C20H24N4O3S/c1-5-23(4)15-8-12(6-7-16(15)25)24-19(21-22-20(24)28)14-9-13(11(2)3)17(26)10-18(14)27/h6-11,25-27H,5H2,1-4H3,(H,22,28)/p+1 |
| InChIKey | KKHPVHJQGILQDV-UHFFFAOYSA-O |
| XLogP | 3.00 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|