C30H37NO3S — CID 143672650
2-[4-[[(3Z)-3-sulfanylhexa-3,5-dienoyl]amino]phenyl]ethyl 5-ethyl-5,8,8-trimethyl-6,7-dihydronaphthalene-2-carboxylate (PubChem CID 143672650) has the molecular formula C30H37NO3S and a molecular weight of 491.70 g/mol. Its IUPAC name is 2-[4-[[(3Z)-3-sulfanylhexa-3,5-dienoyl]amino]phenyl]ethyl 5-ethyl-5,8,8-trimethyl-6,7-dihydronaphthalene-2-carboxylate.
| Compound Name | 2-[4-[[(3Z)-3-sulfanylhexa-3,5-dienoyl]amino]phenyl]ethyl 5-ethyl-5,8,8-trimethyl-6,7-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 143672650 |
| Molecular Formula | C30H37NO3S |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 2-[4-[[(3Z)-3-sulfanylhexa-3,5-dienoyl]amino]phenyl]ethyl 5-ethyl-5,8,8-trimethyl-6,7-dihydronaphthalene-2-carboxylate |
| SMILES | C=C/C=C(\S)CC(=O)Nc1ccc(CCOC(=O)c2ccc3c(c2)C(C)(C)CCC3(C)CC)cc1 |
| InChI | InChI=1S/C30H37NO3S/c1-6-8-24(35)20-27(32)31-23-12-9-21(10-13-23)15-18-34-28(33)22-11-14-25-26(19-22)29(3,4)16-17-30(25,5)7-2/h6,8-14,19,35H,1,7,15-18,20H2,2-5H3,(H,31,32)/b24-8- |
| InChIKey | OQVGFAGHQRVSRL-GYRAYZOKSA-N |
| XLogP | 7.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|