C31H44N2 — CID 143672715
1-[1-[4-methyl-3-[(4-methylpiperidin-1-yl)methyl]phenyl]ethenyl]-4-(4-methylphenyl)piperidine;prop-1-ene (PubChem CID 143672715) has the molecular formula C31H44N2 and a molecular weight of 444.71 g/mol. Its IUPAC name is 1-[1-[4-methyl-3-[(4-methylpiperidin-1-yl)methyl]phenyl]ethenyl]-4-(4-methylphenyl)piperidine;prop-1-ene.
| Compound Name | 1-[1-[4-methyl-3-[(4-methylpiperidin-1-yl)methyl]phenyl]ethenyl]-4-(4-methylphenyl)piperidine;prop-1-ene |
|---|---|
| PubChem CID | 143672715 |
| Molecular Formula | C31H44N2 |
| Molecular Weight | 444.71 g/mol |
| Exact Mass | 444.35 |
| IUPAC Name | 1-[1-[4-methyl-3-[(4-methylpiperidin-1-yl)methyl]phenyl]ethenyl]-4-(4-methylphenyl)piperidine;prop-1-ene |
| SMILES | C=C(c1ccc(C)c(CN2CCC(C)CC2)c1)N1CCC(c2ccc(C)cc2)CC1.C=CC |
| InChI | InChI=1S/C28H38N2.C3H6/c1-21-5-8-25(9-6-21)26-13-17-30(18-14-26)24(4)27-10-7-23(3)28(19-27)20-29-15-11-22(2)12-16-29;1-3-2/h5-10,19,22,26H,4,11-18,20H2,1-3H3;3H,1H2,2H3 |
| InChIKey | GHCSNRCEDKFOMS-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.71 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|