C31H40NO3+ — CID 143672873
[(3S)-3-methyl-7-(2-phenoxyethyl)-7-azoniaspiro[3.5]nonan-3-yl] 1-phenylcyclohept-3-ene-1-carboxylate (PubChem CID 143672873) has the molecular formula C31H40NO3+ and a molecular weight of 474.67 g/mol. Its IUPAC name is [(3S)-3-methyl-7-(2-phenoxyethyl)-7-azoniaspiro[3.5]nonan-3-yl] 1-phenylcyclohept-3-ene-1-carboxylate.
| Compound Name | [(3S)-3-methyl-7-(2-phenoxyethyl)-7-azoniaspiro[3.5]nonan-3-yl] 1-phenylcyclohept-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 143672873 |
| Molecular Formula | C31H40NO3+ |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | [(3S)-3-methyl-7-(2-phenoxyethyl)-7-azoniaspiro[3.5]nonan-3-yl] 1-phenylcyclohept-3-ene-1-carboxylate |
| SMILES | C[C@]1(OC(=O)C2(c3ccccc3)CC=CCCC2)CCC12CC[NH+](CCOc1ccccc1)CC2 |
| InChI | InChI=1S/C31H39NO3/c1-29(35-28(33)31(16-10-2-3-11-17-31)26-12-6-4-7-13-26)18-19-30(29)20-22-32(23-21-30)24-25-34-27-14-8-5-9-15-27/h2,4-10,12-15H,3,11,16-25H2,1H3/p+1/t29-,31?/m0/s1 |
| InChIKey | WBSPTZMDCGOAQT-QHSFNAQHSA-O |
| XLogP | 4.89 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|