C25H35N5O2 — CID 143673670
(4E,6E,8Z,11Z)-8-ethylidene-9-methyl-17-(2-pyrrolidin-1-ylethoxy)-14-oxa-2,4,9-triazabicyclo[14.3.1]icosa-1(20),2,4,6,11,16,18-heptaen-3-amine (PubChem CID 143673670) has the molecular formula C25H35N5O2 and a molecular weight of 437.59 g/mol. Its IUPAC name is (4E,6E,8Z,11Z)-8-ethylidene-9-methyl-17-(2-pyrrolidin-1-ylethoxy)-14-oxa-2,4,9-triazabicyclo[14.3.1]icosa-1(20),2,4,6,11,16,18-heptaen-3-amine.
| Compound Name | (4E,6E,8Z,11Z)-8-ethylidene-9-methyl-17-(2-pyrrolidin-1-ylethoxy)-14-oxa-2,4,9-triazabicyclo[14.3.1]icosa-1(20),2,4,6,11,16,18-heptaen-3-amine |
|---|---|
| PubChem CID | 143673670 |
| Molecular Formula | C25H35N5O2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | (4E,6E,8Z,11Z)-8-ethylidene-9-methyl-17-(2-pyrrolidin-1-ylethoxy)-14-oxa-2,4,9-triazabicyclo[14.3.1]icosa-1(20),2,4,6,11,16,18-heptaen-3-amine |
| SMILES | C/C=C1/C=C/C=N\C(N)=N\c2ccc(OCCN3CCCC3)c(c2)COC/C=C\CN1C |
| InChI | InChI=1S/C25H35N5O2/c1-3-23-9-8-12-27-25(26)28-22-10-11-24(32-18-16-30-14-4-5-15-30)21(19-22)20-31-17-7-6-13-29(23)2/h3,6-12,19H,4-5,13-18,20H2,1-2H3,(H2,26,28)/b7-6-,9-8+,23-3-,27-12- |
| InChIKey | YAEMYYDDQIKAML-OCFHDDGVSA-N |
| XLogP | 3.66 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|