C23H36N4O9 — CID 143674342
2-[4,7-bis(carboxymethyl)-10-[(2,4,6-trihydroxy-3,5-dimethylphenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 143674342) has the molecular formula C23H36N4O9 and a molecular weight of 512.56 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[(2,4,6-trihydroxy-3,5-dimethylphenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[(2,4,6-trihydroxy-3,5-dimethylphenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 143674342 |
| Molecular Formula | C23H36N4O9 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[(2,4,6-trihydroxy-3,5-dimethylphenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | Cc1c(O)c(C)c(O)c(CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)c1O |
| InChI | InChI=1S/C23H36N4O9/c1-15-21(34)16(2)23(36)17(22(15)35)11-24-3-5-25(12-18(28)29)7-9-27(14-20(32)33)10-8-26(6-4-24)13-19(30)31/h34-36H,3-14H2,1-2H3,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | TXSGYQCMXIWYRM-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 185.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|